Sign In | Join Free | My bushorchimp.com |
|
Place of Origin : China
Brand Name : Seabol
Certification : ISO,API
Model Number : FD-8650
MOQ : 5pcs
Price : 1~100USD/PC
Packaging Details : 1500kg/ Wooden Pallet
Delivery Time : 15-20days
Payment Terms : TT,LC,DP
Supply Ability : 5000PCS/Month
Descrition:
Camlock coupling (cam and groove quick coupling)
Acoples rapidos kamlock (RACORES CAMLOCK, de levas, acoples rapidos a palanca)
Fabricados de acuerdo a la Especificacion MIL-C-27487 o DIN2828.
1) Material: Brass, aluminum, stainless steel 316, stainless steel 304, nylon, polypropylene(PP)
2) Type: A, B, C, D, E, F, DC, and DP.
3) Size: 1/2", 3/4", 1", 1-1/4", 1-1/2", 1-3/4", 2", 2-1/2", 3", 4", 5" and 6".
4) Feature:
(1) Precisely machined for accurate fit, join fast and save effort.
(2) Recess holds gasket firmly in place assuring proper placement.
(3) Smooth face of groove and great resistance to vibration.
5) We are the qualified member of NFPA.
Camlock Coupling TYPE A, B, C, D, E, F, DC, DP (Aluminum)
Material: Aluminum Alloy
Casting method: Gravity casting
Surface Finish: T6 Heat treatment
Handle: Brass & stainless steel
Sealing: NBR, EPDM, Viton, PTF
Safey Pin: Steel
Thread: ISO228(BSP)/ISO7(BSPT)/ANSI B1.20(NPT)
Size: 1/2", 3/4", 1", 1 1/4", 1 1/2", 2", 2 1/2", 3", 4", 5", 6"
6)Standard: A-A-59326(Repalced MIL-C-27487) or DIN2828
7)Technic:Die Casting, Gravity casting, precision Casting, Sand Casting, Forging, and Injection Moulding
Application:
Camlock coupling is used in a wide variety of applications for petroleum handling, chemical processing, dry bulk handling, agricultural, and water, etc.
Specification:
Aluminium |
|
PP |
|
|
|
Brass |
|
|||
Type |
|
SIZE |
|
Type |
|
SIZE |
|
Type |
|
SIZE |
A |
|
1/2" |
|
A |
|
1/2" |
|
A |
|
1/2" |
B |
|
3/4" |
|
B |
|
3/4" |
|
B |
|
3/4" |
C |
|
1" |
|
C |
|
1" |
|
C |
|
1" |
D |
|
1-1/4" |
|
D |
|
1-1/4" |
|
D |
|
1-1/4" |
E |
|
1-1/2" |
|
E |
|
1-1/2" |
|
E |
|
1-1/2" |
F |
|
2" |
|
F |
|
2" |
|
F |
|
2" |
DC |
|
2-1/2" |
|
DC |
|
2-1/2" |
|
DC |
|
2-1/2" |
DP |
|
3" |
|
DP |
|
3" |
|
DP |
|
3" |
|
|
4" |
|
|
|
4" |
|
|
|
4" |
|
|
5" |
|
|
|
|
|
|
|
5" |
|
|
6" |
|
|
|
|
|
|
|
6" |
|
|
8" |
|
|
|
|
|
|
|
|
Stainless Steel |
|
Nylon |
|
|
|
|
|
|||
Type |
|
SIZE |
|
Type |
|
SIZE |
|
|
|
|
A |
|
1/2" |
|
A |
|
1/2" |
|
|
|
|
B |
|
3/4" |
|
B |
|
3/4" |
|
|
|
|
C |
|
1" |
|
C |
|
1" |
|
|
|
|
D |
|
1-1/4" |
|
D |
|
1-1/4" |
|
|
|
|
E |
|
1-1/2" |
|
E |
|
1-1/2" |
|
|
|
|
F |
|
2" |
|
F |
|
2" |
|
|
|
|
DC |
|
2-1/2" |
|
DC |
|
2-1/2" |
|
|
|
|
DP |
|
3" |
|
DP |
|
3" |
|
|
|
|
|
|
4" |
|
|
|
4" |
|
|
|
|
|
|
5" |
|
|
|
|
|
|
|
|
|
|
6" |
|
|
|
|
|
|
|
|
Competitive Advantage:
1. Reasonable price with excellent quality
2. Abundant stock and prompt delivery
3. Rich supply and export experience, sincere service
4. Reliable forwarder, 1-hour away from port.
![]() |
Camlock Coupling/Hose Coupling Images |